C15H9ClN2OS2 — CID 2824240
S-(4-chlorophenyl) 2-pyridin-3-yl-1,3-thiazole-4-carbothioate (PubChem CID 2824240) has the molecular formula C15H9ClN2OS2 and a molecular weight of 332.84 g/mol. Its IUPAC name is S-(4-chlorophenyl) 2-pyridin-3-yl-1,3-thiazole-4-carbothioate.
| Compound Name | S-(4-chlorophenyl) 2-pyridin-3-yl-1,3-thiazole-4-carbothioate |
|---|---|
| PubChem CID | 2824240 |
| Molecular Formula | C15H9ClN2OS2 |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | S-(4-chlorophenyl) 2-pyridin-3-yl-1,3-thiazole-4-carbothioate |
| SMILES | O=C(Sc1ccc(Cl)cc1)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C15H9ClN2OS2/c16-11-3-5-12(6-4-11)21-15(19)13-9-20-14(18-13)10-2-1-7-17-8-10/h1-9H |
| InChIKey | OINGAJSPTQSEEE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|