C17H14ClN3S2 — CID 2824330
1-(4-chlorophenyl)-3-[(3-methyl-1-benzothiophen-2-yl)methylideneamino]thiourea (PubChem CID 2824330) has the molecular formula C17H14ClN3S2 and a molecular weight of 359.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(3-methyl-1-benzothiophen-2-yl)methylideneamino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(3-methyl-1-benzothiophen-2-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 2824330 |
| Molecular Formula | C17H14ClN3S2 |
| Molecular Weight | 359.91 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(3-methyl-1-benzothiophen-2-yl)methylideneamino]thiourea |
| SMILES | Cc1c(C=NNC(=S)Nc2ccc(Cl)cc2)sc2ccccc12 |
| InChI | InChI=1S/C17H14ClN3S2/c1-11-14-4-2-3-5-15(14)23-16(11)10-19-21-17(22)20-13-8-6-12(18)7-9-13/h2-10H,1H3,(H2,20,21,22) |
| InChIKey | BJLJEVXPVSSWTG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.91 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|