C17H15ClN6S2 — CID 6413141
1-[(Z)-[5-(4-chloroanilino)-1,3,4-thiadiazol-2-yl]methylideneamino]-3-(4-methylphenyl)thiourea (PubChem CID 6413141) has the molecular formula C17H15ClN6S2 and a molecular weight of 402.94 g/mol. Its IUPAC name is 1-[(Z)-[5-(4-chloroanilino)-1,3,4-thiadiazol-2-yl]methylideneamino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[(Z)-[5-(4-chloroanilino)-1,3,4-thiadiazol-2-yl]methylideneamino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 6413141 |
| Molecular Formula | C17H15ClN6S2 |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 1-[(Z)-[5-(4-chloroanilino)-1,3,4-thiadiazol-2-yl]methylideneamino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N/N=C\c2nnc(Nc3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C17H15ClN6S2/c1-11-2-6-13(7-3-11)20-16(25)23-19-10-15-22-24-17(26-15)21-14-8-4-12(18)5-9-14/h2-10H,1H3,(H,21,24)(H2,20,23,25)/b19-10- |
| InChIKey | QJQJSRSUMPRQKG-GRSHGNNSSA-N |
| XLogP | 4.56 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|