C10H7Cl3N2O — CID 2825130
5-methyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one (PubChem CID 2825130) has the molecular formula C10H7Cl3N2O and a molecular weight of 277.54 g/mol. Its IUPAC name is 5-methyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one.
| Compound Name | 5-methyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 2825130 |
| Molecular Formula | C10H7Cl3N2O |
| Molecular Weight | 277.54 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 5-methyl-2-(2,4,6-trichlorophenyl)-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C10H7Cl3N2O/c1-5-2-9(16)15(14-5)10-7(12)3-6(11)4-8(10)13/h3-4H,2H2,1H3 |
| InChIKey | MRQNFRMHWBTRGX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |