C14H14Cl3N3O2 — CID 1070678
2,2-dimethyl-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]propanamide (PubChem CID 1070678) has the molecular formula C14H14Cl3N3O2 and a molecular weight of 362.64 g/mol. Its IUPAC name is 2,2-dimethyl-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 1070678 |
| Molecular Formula | C14H14Cl3N3O2 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2,2-dimethyl-N-[5-oxo-1-(2,4,6-trichlorophenyl)-4H-pyrazol-3-yl]propanamide |
| SMILES | CC(C)(C)C(=O)NC1=NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C14H14Cl3N3O2/c1-14(2,3)13(22)18-10-6-11(21)20(19-10)12-8(16)4-7(15)5-9(12)17/h4-5H,6H2,1-3H3,(H,18,19,22) |
| InChIKey | YCYWROSNEOCQKO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_5_B(4)', 'substructure': 'N/A'} |
|---|