C18H26Cl2N2O2 — CID 28271
(2-piperidin-1-ium-1-ylcyclohexyl) N-(2-chlorophenyl)carbamate chloride (PubChem CID 28271) has the molecular formula C18H26Cl2N2O2 and a molecular weight of 373.32 g/mol. Its IUPAC name is (2-piperidin-1-ium-1-ylcyclohexyl) N-(2-chlorophenyl)carbamate chloride.
| Compound Name | (2-piperidin-1-ium-1-ylcyclohexyl) N-(2-chlorophenyl)carbamate chloride |
|---|---|
| PubChem CID | 28271 |
| Molecular Formula | C18H26Cl2N2O2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (2-piperidin-1-ium-1-ylcyclohexyl) N-(2-chlorophenyl)carbamate chloride |
| SMILES | O=C(Nc1ccccc1Cl)OC1CCCCC1[NH+]1CCCCC1.[Cl-] |
| InChI | InChI=1S/C18H25ClN2O2.ClH/c19-14-8-2-3-9-15(14)20-18(22)23-17-11-5-4-10-16(17)21-12-6-1-7-13-21;/h2-3,8-9,16-17H,1,4-7,10-13H2,(H,20,22);1H |
| InChIKey | NEOYGHHVSMRCCX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |