C10H18OS — CID 2827615
2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-4-ol (PubChem CID 2827615) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-4-ol.
| Compound Name | 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-4-ol |
|---|---|
| PubChem CID | 2827615 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 2-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-thiochromen-4-ol |
| SMILES | CC1CC(O)C2CCCCC2S1 |
| InChI | InChI=1S/C10H18OS/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h7-11H,2-6H2,1H3 |
| InChIKey | CWIVGUWZIZKJQN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |