C11H20OS2 — CID 135038715
cis-(1R,2S)-2-(1,3-dithian-2-ylmethyl)cyclohexan-1-ol (PubChem CID 135038715) has the molecular formula C11H20OS2 and a molecular weight of 232.41 g/mol. Its IUPAC name is cis-(1R,2S)-2-(1,3-dithian-2-ylmethyl)cyclohexan-1-ol.
| Compound Name | cis-(1R,2S)-2-(1,3-dithian-2-ylmethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 135038715 |
| Molecular Formula | C11H20OS2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | cis-(1R,2S)-2-(1,3-dithian-2-ylmethyl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1CC1SCCCS1 |
| InChI | InChI=1S/C11H20OS2/c12-10-5-2-1-4-9(10)8-11-13-6-3-7-14-11/h9-12H,1-8H2/t9-,10+/m0/s1 |
| InChIKey | LPLIAQABRCORSA-VHSXEESVSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |