About cyclohexyl(1,3-dithian-2-yl)methanol
cyclohexyl(1,3-dithian-2-yl)methanol (PubChem CID 12556860) has the molecular formula C11H20OS2
and a molecular weight of 232.41 g/mol. Its IUPAC name is cyclohexyl(1,3-dithian-2-yl)methanol.
Molecular Properties
| Compound Name | cyclohexyl(1,3-dithian-2-yl)methanol |
| PubChem CID | 12556860 |
| Molecular Formula | C11H20OS2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | cyclohexyl(1,3-dithian-2-yl)methanol |
| SMILES | OC(C1CCCCC1)C1SCCCS1 |
| InChI | InChI=1S/C11H20OS2/c12-10(9-5-2-1-3-6-9)11-13-7-4-8-14-11/h9-12H,1-8H2 |
| InChIKey | UXXSGJJANIRJEE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl(1,3-dithian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl(1,3-dithian-2-yl)methanol?
The IUPAC name of cyclohexyl(1,3-dithian-2-yl)methanol (CID 12556860) is cyclohexyl(1,3-dithian-2-yl)methanol.
What is the SMILES notation for cyclohexyl(1,3-dithian-2-yl)methanol?
The canonical SMILES for cyclohexyl(1,3-dithian-2-yl)methanol is OC(C1CCCCC1)C1SCCCS1.
What is the InChIKey of cyclohexyl(1,3-dithian-2-yl)methanol?
The InChIKey is UXXSGJJANIRJEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS2/c12-10(9-5-2-1-3-6-9)11-13-7-4-8-14-11/h9-12H,1-8H2.
What are the key properties of cyclohexyl(1,3-dithian-2-yl)methanol?
cyclohexyl(1,3-dithian-2-yl)methanol has a molecular weight of 232.41 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl(1,3-dithian-2-yl)methanol is sourced from PubChem (CID 12556860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).