C13H26O2S2 — CID 10934785
(3R,4R,6R)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-3,4-diol (PubChem CID 10934785) has the molecular formula C13H26O2S2 and a molecular weight of 278.48 g/mol. Its IUPAC name is (3R,4R,6R)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-3,4-diol.
| Compound Name | (3R,4R,6R)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-3,4-diol |
|---|---|
| PubChem CID | 10934785 |
| Molecular Formula | C13H26O2S2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (3R,4R,6R)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-3,4-diol |
| SMILES | CC(C)[C@@H](O)[C@H](O)C[C@@H](C)CC1SCCCS1 |
| InChI | InChI=1S/C13H26O2S2/c1-9(2)13(15)11(14)7-10(3)8-12-16-5-4-6-17-12/h9-15H,4-8H2,1-3H3/t10-,11-,13-/m1/s1 |
| InChIKey | BRURTUMENVKWIR-NQBHXWOUSA-N |
| XLogP | 2.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |