C12H24O2S2 — CID 121002882
(2S,3S,4R)-1-(1,3-dithian-2-yl)-3,5-dimethylhexane-2,4-diol (PubChem CID 121002882) has the molecular formula C12H24O2S2 and a molecular weight of 264.46 g/mol. Its IUPAC name is (2S,3S,4R)-1-(1,3-dithian-2-yl)-3,5-dimethylhexane-2,4-diol.
| Compound Name | (2S,3S,4R)-1-(1,3-dithian-2-yl)-3,5-dimethylhexane-2,4-diol |
|---|---|
| PubChem CID | 121002882 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2S,3S,4R)-1-(1,3-dithian-2-yl)-3,5-dimethylhexane-2,4-diol |
| SMILES | CC(C)[C@@H](O)[C@@H](C)[C@@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C12H24O2S2/c1-8(2)12(14)9(3)10(13)7-11-15-5-4-6-16-11/h8-14H,4-7H2,1-3H3/t9-,10-,12+/m0/s1 |
| InChIKey | UMGUDJFMZDNFMM-JBLDHEPKSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |