C11H22OS2 — CID 590014
1-(2-ethyl-1,3-dithian-2-yl)-3-methylbutan-1-ol (PubChem CID 590014) has the molecular formula C11H22OS2 and a molecular weight of 234.43 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-dithian-2-yl)-3-methylbutan-1-ol.
| Compound Name | 1-(2-ethyl-1,3-dithian-2-yl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 590014 |
| Molecular Formula | C11H22OS2 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-(2-ethyl-1,3-dithian-2-yl)-3-methylbutan-1-ol |
| SMILES | CCC1(C(O)CC(C)C)SCCCS1 |
| InChI | InChI=1S/C11H22OS2/c1-4-11(10(12)8-9(2)3)13-6-5-7-14-11/h9-10,12H,4-8H2,1-3H3 |
| InChIKey | CGRRJYSPPBRICH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |