C12H24OS2 — CID 14569689
1-(2-tert-butyl-1,3-dithian-2-yl)butan-1-ol (PubChem CID 14569689) has the molecular formula C12H24OS2 and a molecular weight of 248.46 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-dithian-2-yl)butan-1-ol.
| Compound Name | 1-(2-tert-butyl-1,3-dithian-2-yl)butan-1-ol |
|---|---|
| PubChem CID | 14569689 |
| Molecular Formula | C12H24OS2 |
| Molecular Weight | 248.46 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(2-tert-butyl-1,3-dithian-2-yl)butan-1-ol |
| SMILES | CCCC(O)C1(C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C12H24OS2/c1-5-7-10(13)12(11(2,3)4)14-8-6-9-15-12/h10,13H,5-9H2,1-4H3 |
| InChIKey | SHZPTARAVPRLKG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |