C12H24O3S2 — CID 11974077
(3R,5S)-6-(1,3-dithian-2-yl)-6-methylheptane-1,3,5-triol (PubChem CID 11974077) has the molecular formula C12H24O3S2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (3R,5S)-6-(1,3-dithian-2-yl)-6-methylheptane-1,3,5-triol.
| Compound Name | (3R,5S)-6-(1,3-dithian-2-yl)-6-methylheptane-1,3,5-triol |
|---|---|
| PubChem CID | 11974077 |
| Molecular Formula | C12H24O3S2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (3R,5S)-6-(1,3-dithian-2-yl)-6-methylheptane-1,3,5-triol |
| SMILES | CC(C)(C1SCCCS1)[C@@H](O)C[C@H](O)CCO |
| InChI | InChI=1S/C12H24O3S2/c1-12(2,11-16-6-3-7-17-11)10(15)8-9(14)4-5-13/h9-11,13-15H,3-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | MMEBLINIIDRLRH-ZJUUUORDSA-N |
| XLogP | 1.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |