C14H28OS2 — CID 24976668
7-(2-ethyl-1,3-dithian-2-yl)-2-methylheptan-3-ol (PubChem CID 24976668) has the molecular formula C14H28OS2 and a molecular weight of 276.51 g/mol. Its IUPAC name is 7-(2-ethyl-1,3-dithian-2-yl)-2-methylheptan-3-ol.
| Compound Name | 7-(2-ethyl-1,3-dithian-2-yl)-2-methylheptan-3-ol |
|---|---|
| PubChem CID | 24976668 |
| Molecular Formula | C14H28OS2 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 7-(2-ethyl-1,3-dithian-2-yl)-2-methylheptan-3-ol |
| SMILES | CCC1(CCCCC(O)C(C)C)SCCCS1 |
| InChI | InChI=1S/C14H28OS2/c1-4-14(16-10-7-11-17-14)9-6-5-8-13(15)12(2)3/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | ASUGBZWVCYYJCG-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|