C13H26O3S2 — CID 11197176
(4S,6S)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-2,3,4-triol (PubChem CID 11197176) has the molecular formula C13H26O3S2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (4S,6S)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-2,3,4-triol.
| Compound Name | (4S,6S)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-2,3,4-triol |
|---|---|
| PubChem CID | 11197176 |
| Molecular Formula | C13H26O3S2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (4S,6S)-7-(1,3-dithian-2-yl)-2,6-dimethylheptane-2,3,4-triol |
| SMILES | C[C@H](CC1SCCCS1)C[C@H](O)C(O)C(C)(C)O |
| InChI | InChI=1S/C13H26O3S2/c1-9(8-11-17-5-4-6-18-11)7-10(14)12(15)13(2,3)16/h9-12,14-16H,4-8H2,1-3H3/t9-,10-,12?/m0/s1 |
| InChIKey | BHQRYGYZCURDIS-HVFQMFNGSA-N |
| XLogP | 2.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |