C11H22O2S2 — CID 134985708
(2S,3R,5S)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2-diol (PubChem CID 134985708) has the molecular formula C11H22O2S2 and a molecular weight of 250.43 g/mol. Its IUPAC name is (2S,3R,5S)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2-diol.
| Compound Name | (2S,3R,5S)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2-diol |
|---|---|
| PubChem CID | 134985708 |
| Molecular Formula | C11H22O2S2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (2S,3R,5S)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2-diol |
| SMILES | C[C@H](C[C@H](C)C1SCCCS1)[C@H](O)CO |
| InChI | InChI=1S/C11H22O2S2/c1-8(10(13)7-12)6-9(2)11-14-4-3-5-15-11/h8-13H,3-7H2,1-2H3/t8-,9+,10-/m1/s1 |
| InChIKey | OTSLZTNBBIQKMV-KXUCPTDWSA-N |
| XLogP | 2.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |