C11H22O3S2 — CID 134895183
(2S,3R,4S,5R)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2,4-triol (PubChem CID 134895183) has the molecular formula C11H22O3S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is (2S,3R,4S,5R)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2,4-triol.
| Compound Name | (2S,3R,4S,5R)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2,4-triol |
|---|---|
| PubChem CID | 134895183 |
| Molecular Formula | C11H22O3S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (2S,3R,4S,5R)-5-(1,3-dithian-2-yl)-3-methylhexane-1,2,4-triol |
| SMILES | C[C@H]([C@H](O)[C@@H](C)C1SCCCS1)[C@H](O)CO |
| InChI | InChI=1S/C11H22O3S2/c1-7(9(13)6-12)10(14)8(2)11-15-4-3-5-16-11/h7-14H,3-6H2,1-2H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | VIZQDPGSXJKSHK-JLIMGVALSA-N |
| XLogP | 1.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |