C10H20O3S2 — CID 14891736
(1S,2R)-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,2,4-triol (PubChem CID 14891736) has the molecular formula C10H20O3S2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1S,2R)-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,2,4-triol.
| Compound Name | (1S,2R)-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 14891736 |
| Molecular Formula | C10H20O3S2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (1S,2R)-1-(1,3-dithian-2-yl)-3,3-dimethylbutane-1,2,4-triol |
| SMILES | CC(C)(CO)[C@@H](O)[C@H](O)C1SCCCS1 |
| InChI | InChI=1S/C10H20O3S2/c1-10(2,6-11)8(13)7(12)9-14-4-3-5-15-9/h7-9,11-13H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | SBBRVLWOCYMKOI-YUMQZZPRSA-N |
| XLogP | 0.92 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |