C12H24O2S2 — CID 10730358
(3R,5R)-5-(1,3-dithian-2-yl)-2,2-dimethylhexane-1,3-diol (PubChem CID 10730358) has the molecular formula C12H24O2S2 and a molecular weight of 264.46 g/mol. Its IUPAC name is (3R,5R)-5-(1,3-dithian-2-yl)-2,2-dimethylhexane-1,3-diol.
| Compound Name | (3R,5R)-5-(1,3-dithian-2-yl)-2,2-dimethylhexane-1,3-diol |
|---|---|
| PubChem CID | 10730358 |
| Molecular Formula | C12H24O2S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (3R,5R)-5-(1,3-dithian-2-yl)-2,2-dimethylhexane-1,3-diol |
| SMILES | C[C@H](C[C@@H](O)C(C)(C)CO)C1SCCCS1 |
| InChI | InChI=1S/C12H24O2S2/c1-9(11-15-5-4-6-16-11)7-10(14)12(2,3)8-13/h9-11,13-14H,4-8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | XONDKYXAEMQBJL-NXEZZACHSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |