C14H28O3S — CID 123203403
4-(butylsulfanylmethyl)-7-ethylcycloheptane-1,2,3-triol (PubChem CID 123203403) has the molecular formula C14H28O3S and a molecular weight of 276.44 g/mol. Its IUPAC name is 4-(butylsulfanylmethyl)-7-ethylcycloheptane-1,2,3-triol.
| Compound Name | 4-(butylsulfanylmethyl)-7-ethylcycloheptane-1,2,3-triol |
|---|---|
| PubChem CID | 123203403 |
| Molecular Formula | C14H28O3S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-(butylsulfanylmethyl)-7-ethylcycloheptane-1,2,3-triol |
| SMILES | CCCCSCC1CCC(CC)C(O)C(O)C1O |
| InChI | InChI=1S/C14H28O3S/c1-3-5-8-18-9-11-7-6-10(4-2)12(15)14(17)13(11)16/h10-17H,3-9H2,1-2H3 |
| InChIKey | QKQQGEJZDIETPY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|