C16H31IO3S2 — CID 134990453
(2R,4S,5S,6S,8R)-8-(1,3-dithian-2-yl)-1-iodo-4,6-dimethoxy-2-methylnonan-5-ol (PubChem CID 134990453) has the molecular formula C16H31IO3S2 and a molecular weight of 462.46 g/mol. Its IUPAC name is (2R,4S,5S,6S,8R)-8-(1,3-dithian-2-yl)-1-iodo-4,6-dimethoxy-2-methylnonan-5-ol.
| Compound Name | (2R,4S,5S,6S,8R)-8-(1,3-dithian-2-yl)-1-iodo-4,6-dimethoxy-2-methylnonan-5-ol |
|---|---|
| PubChem CID | 134990453 |
| Molecular Formula | C16H31IO3S2 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | (2R,4S,5S,6S,8R)-8-(1,3-dithian-2-yl)-1-iodo-4,6-dimethoxy-2-methylnonan-5-ol |
| SMILES | CO[C@@H](C[C@@H](C)CI)[C@@H](O)[C@H](C[C@@H](C)C1SCCCS1)OC |
| InChI | InChI=1S/C16H31IO3S2/c1-11(10-17)8-13(19-3)15(18)14(20-4)9-12(2)16-21-6-5-7-22-16/h11-16,18H,5-10H2,1-4H3/t11-,12-,13+,14+,15-/m1/s1 |
| InChIKey | YBSHUNHMIPHRKR-NIFZNCRKSA-N |
| XLogP | 4.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|