C13H26O3S2 — CID 163449592
6-[1,1-bis(methylsulfanyl)propan-2-yl]-2-(2-hydroxyethyl)-5-methyloxan-3-ol (PubChem CID 163449592) has the molecular formula C13H26O3S2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 6-[1,1-bis(methylsulfanyl)propan-2-yl]-2-(2-hydroxyethyl)-5-methyloxan-3-ol.
| Compound Name | 6-[1,1-bis(methylsulfanyl)propan-2-yl]-2-(2-hydroxyethyl)-5-methyloxan-3-ol |
|---|---|
| PubChem CID | 163449592 |
| Molecular Formula | C13H26O3S2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 6-[1,1-bis(methylsulfanyl)propan-2-yl]-2-(2-hydroxyethyl)-5-methyloxan-3-ol |
| SMILES | CSC(SC)C(C)C1OC(CCO)C(O)CC1C |
| InChI | InChI=1S/C13H26O3S2/c1-8-7-10(15)11(5-6-14)16-12(8)9(2)13(17-3)18-4/h8-15H,5-7H2,1-4H3 |
| InChIKey | BFMGOKUEKLOMIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|