C10H20O2S — CID 58723190
(2R,3S,4S,5R)-2-ethyl-4,5-dimethyl-6-methylsulfanyloxan-3-ol (PubChem CID 58723190) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-ethyl-4,5-dimethyl-6-methylsulfanyloxan-3-ol.
| Compound Name | (2R,3S,4S,5R)-2-ethyl-4,5-dimethyl-6-methylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 58723190 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R,3S,4S,5R)-2-ethyl-4,5-dimethyl-6-methylsulfanyloxan-3-ol |
| SMILES | CC[C@H]1OC(SC)[C@H](C)[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C10H20O2S/c1-5-8-9(11)6(2)7(3)10(12-8)13-4/h6-11H,5H2,1-4H3/t6-,7+,8+,9-,10?/m0/s1 |
| InChIKey | BZRQOYMOIWPWRE-YHTCJBSDSA-N |
| XLogP | 2.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |