C10H20O3S2 — CID 11402524
(3S,5R)-6-(1,3-dithian-2-yl)hexane-1,3,5-triol (PubChem CID 11402524) has the molecular formula C10H20O3S2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (3S,5R)-6-(1,3-dithian-2-yl)hexane-1,3,5-triol.
| Compound Name | (3S,5R)-6-(1,3-dithian-2-yl)hexane-1,3,5-triol |
|---|---|
| PubChem CID | 11402524 |
| Molecular Formula | C10H20O3S2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (3S,5R)-6-(1,3-dithian-2-yl)hexane-1,3,5-triol |
| SMILES | OCC[C@H](O)C[C@@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C10H20O3S2/c11-3-2-8(12)6-9(13)7-10-14-4-1-5-15-10/h8-13H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | NYAAKHZINSYUQB-DTWKUNHWSA-N |
| XLogP | 1.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |