C17H12ClN5O4 — CID 2828048
6-chloro-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]benzo[de]isoquinoline-1,3-dione (PubChem CID 2828048) has the molecular formula C17H12ClN5O4 and a molecular weight of 385.77 g/mol. Its IUPAC name is 6-chloro-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-chloro-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2828048 |
| Molecular Formula | C17H12ClN5O4 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 6-chloro-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1nn(C)c(NN2C(=O)c3cccc4c(Cl)ccc(c34)C2=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12ClN5O4/c1-8-14(23(26)27)15(21(2)19-8)20-22-16(24)10-5-3-4-9-12(18)7-6-11(13(9)10)17(22)25/h3-7,20H,1-2H3 |
| InChIKey | ANUITJULPBPBHL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|