C14H13ClN2O5 — CID 2830837
prop-2-ynyl 5-(4-chloro-2-nitroanilino)-5-oxopentanoate (PubChem CID 2830837) has the molecular formula C14H13ClN2O5 and a molecular weight of 324.72 g/mol. Its IUPAC name is prop-2-ynyl 5-(4-chloro-2-nitroanilino)-5-oxopentanoate.
| Compound Name | prop-2-ynyl 5-(4-chloro-2-nitroanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 2830837 |
| Molecular Formula | C14H13ClN2O5 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | prop-2-ynyl 5-(4-chloro-2-nitroanilino)-5-oxopentanoate |
| SMILES | C#CCOC(=O)CCCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13ClN2O5/c1-2-8-22-14(19)5-3-4-13(18)16-11-7-6-10(15)9-12(11)17(20)21/h1,6-7,9H,3-5,8H2,(H,16,18) |
| InChIKey | YTKSPBNRETZKMR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|