C11H20ClNO2 — CID 2831824
1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-yl acetate;hydrochloride (PubChem CID 2831824) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-yl acetate;hydrochloride.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-yl acetate;hydrochloride |
|---|---|
| PubChem CID | 2831824 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-7-yl acetate;hydrochloride |
| SMILES | CC(=O)OC1CCC2CCCNC2C1.Cl |
| InChI | InChI=1S/C11H19NO2.ClH/c1-8(13)14-10-5-4-9-3-2-6-12-11(9)7-10;/h9-12H,2-7H2,1H3;1H |
| InChIKey | SRCQKERUQNQIIK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |