C12H20O3 — CID 6427576
[(2R,6R)-6-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] acetate (PubChem CID 6427576) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is [(2R,6R)-6-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] acetate.
| Compound Name | [(2R,6R)-6-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 6427576 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [(2R,6R)-6-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC2C[C@H](O)CCC2C1 |
| InChI | InChI=1S/C12H20O3/c1-8(13)15-12-5-3-9-6-11(14)4-2-10(9)7-12/h9-12,14H,2-7H2,1H3/t9?,10?,11-,12-/m1/s1 |
| InChIKey | KGOAGXZCQFDBOX-KIDURHIOSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |