C9H13ClO3 — CID 127260731
[(1S,3R)-3-(2-chloro-2-oxoethyl)cyclopentyl] acetate (PubChem CID 127260731) has the molecular formula C9H13ClO3 and a molecular weight of 204.65 g/mol. Its IUPAC name is [(1S,3R)-3-(2-chloro-2-oxoethyl)cyclopentyl] acetate.
| Compound Name | [(1S,3R)-3-(2-chloro-2-oxoethyl)cyclopentyl] acetate |
|---|---|
| PubChem CID | 127260731 |
| Molecular Formula | C9H13ClO3 |
| Molecular Weight | 204.65 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | [(1S,3R)-3-(2-chloro-2-oxoethyl)cyclopentyl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H](CC(=O)Cl)C1 |
| InChI | InChI=1S/C9H13ClO3/c1-6(11)13-8-3-2-7(4-8)5-9(10)12/h7-8H,2-5H2,1H3/t7-,8+/m1/s1 |
| InChIKey | LSSRVKUICLGOEI-SFYZADRCSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.65 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|