About [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate
[3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate (PubChem CID 131856151) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate.
Analyze [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate?
The IUPAC name of [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate (CID 131856151) is [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate.
What is the SMILES notation for [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate?
The canonical SMILES for [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate is CC(=O)OC1CCC(CC2(C)OCCO2)C1.
What is the InChIKey of [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate?
The InChIKey is KLFUBZFNZHFWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-9(13)16-11-4-3-10(7-11)8-12(2)14-5-6-15-12/h10-11H,3-8H2,1-2H3.
What are the key properties of [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate?
[3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate has a molecular weight of 228.29 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-methyl-1,3-dioxolan-2-yl)methyl]cyclopentyl] acetate is sourced from PubChem (CID 131856151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).