About (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate
(4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate (PubChem CID 161130636) has the molecular formula C17H27ClO7
and a molecular weight of 378.85 g/mol. Its IUPAC name is (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate.
Molecular Properties
| Compound Name | (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate |
| PubChem CID | 161130636 |
| Molecular Formula | C17H27ClO7 |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate |
| SMILES | CC(=O)OC1CCC(O)CC1.CC(=O)OC1CCC(OC(=O)Cl)CC1 |
| InChI | InChI=1S/C9H13ClO4.C8H14O3/c1-6(11)13-7-2-4-8(5-3-7)14-9(10)12;1-6(9)11-8-4-2-7(10)3-5-8/h7-8H,2-5H2,1H3;7-8,10H,2-5H2,1H3 |
| InChIKey | UMDCRSQDZFXFGO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate?
The IUPAC name of (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate (CID 161130636) is (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate.
What is the SMILES notation for (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate?
The canonical SMILES for (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate is CC(=O)OC1CCC(O)CC1.CC(=O)OC1CCC(OC(=O)Cl)CC1.
What is the InChIKey of (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate?
The InChIKey is UMDCRSQDZFXFGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClO4.C8H14O3/c1-6(11)13-7-2-4-8(5-3-7)14-9(10)12;1-6(9)11-8-4-2-7(10)3-5-8/h7-8H,2-5H2,1H3;7-8,10H,2-5H2,1H3.
What are the key properties of (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate?
(4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate has a molecular weight of 378.85 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbonochloridoyloxycyclohexyl) acetate;(4-hydroxycyclohexyl) acetate is sourced from PubChem (CID 161130636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).