C25H22N2O — CID 2832320
N-(4-cyanophenyl)-2,2-bis(4-methylphenyl)cyclopropane-1-carboxamide (PubChem CID 2832320) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2,2-bis(4-methylphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-(4-cyanophenyl)-2,2-bis(4-methylphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2832320 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(4-cyanophenyl)-2,2-bis(4-methylphenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)CC2C(=O)Nc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C25H22N2O/c1-17-3-9-20(10-4-17)25(21-11-5-18(2)6-12-21)15-23(25)24(28)27-22-13-7-19(16-26)8-14-22/h3-14,23H,15H2,1-2H3,(H,27,28) |
| InChIKey | GYYJPQIQHRRVSK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |