C16H17FN2O6 — CID 2837463
2-[[2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid (PubChem CID 2837463) has the molecular formula C16H17FN2O6 and a molecular weight of 352.32 g/mol. Its IUPAC name is 2-[[2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 2837463 |
| Molecular Formula | C16H17FN2O6 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-[[2-acetamido-3-(4-fluorophenyl)prop-2-enoyl]amino]pentanedioic acid |
| SMILES | CC(=O)NC(=Cc1ccc(F)cc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H17FN2O6/c1-9(20)18-13(8-10-2-4-11(17)5-3-10)15(23)19-12(16(24)25)6-7-14(21)22/h2-5,8,12H,6-7H2,1H3,(H,18,20)(H,19,23)(H,21,22)(H,24,25) |
| InChIKey | DFNQDLXRICZEMZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|