C13H15BrN2O2S — CID 2842738
2-(1,3-benzothiazol-3-ium-3-yl)-1-morpholin-4-ylethanone bromide (PubChem CID 2842738) has the molecular formula C13H15BrN2O2S and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-3-ium-3-yl)-1-morpholin-4-ylethanone bromide.
| Compound Name | 2-(1,3-benzothiazol-3-ium-3-yl)-1-morpholin-4-ylethanone bromide |
|---|---|
| PubChem CID | 2842738 |
| Molecular Formula | C13H15BrN2O2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-(1,3-benzothiazol-3-ium-3-yl)-1-morpholin-4-ylethanone bromide |
| SMILES | O=C(C[n+]1csc2ccccc21)N1CCOCC1.[Br-] |
| InChI | InChI=1S/C13H15N2O2S.BrH/c16-13(14-5-7-17-8-6-14)9-15-10-18-12-4-2-1-3-11(12)15;/h1-4,10H,5-9H2;1H/q+1;/p-1 |
| InChIKey | ABKHGTDEKMWAMW-UHFFFAOYSA-M |
| XLogP | -1.95 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|