C15H19F3N4 — CID 2843464
N,N-diethyl-N'-[2-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]methanimidamide (PubChem CID 2843464) has the molecular formula C15H19F3N4 and a molecular weight of 312.34 g/mol. Its IUPAC name is N,N-diethyl-N'-[2-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]methanimidamide.
| Compound Name | N,N-diethyl-N'-[2-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]methanimidamide |
|---|---|
| PubChem CID | 2843464 |
| Molecular Formula | C15H19F3N4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N,N-diethyl-N'-[2-[3-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]methanimidamide |
| SMILES | CCN(/C=N/C1=NN(c2cccc(C(F)(F)F)c2)CC1)CC |
| InChI | InChI=1S/C15H19F3N4/c1-3-21(4-2)11-19-14-8-9-22(20-14)13-7-5-6-12(10-13)15(16,17)18/h5-7,10-11H,3-4,8-9H2,1-2H3/b19-11+ |
| InChIKey | QKCONXZIFOPPRF-YBFXNURJSA-N |
| XLogP | 3.60 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_imine_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|