C13H14F3N3 — CID 135986984
N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-imine (PubChem CID 135986984) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-imine.
| Compound Name | N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-imine |
|---|---|
| PubChem CID | 135986984 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-prop-2-enyl-1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-imine |
| SMILES | C=CC/N=C1\CCN(c2cccc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C13H14F3N3/c1-2-7-17-12-6-8-19(18-12)11-5-3-4-10(9-11)13(14,15)16/h2-5,9H,1,6-8H2,(H,17,18) |
| InChIKey | RBTCNSSFPWJQKQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|