C11H11F3N4S — CID 135401667
(E)-[1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-ylidene]thiourea (PubChem CID 135401667) has the molecular formula C11H11F3N4S and a molecular weight of 288.30 g/mol. Its IUPAC name is (E)-[1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-ylidene]thiourea.
| Compound Name | (E)-[1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-ylidene]thiourea |
|---|---|
| PubChem CID | 135401667 |
| Molecular Formula | C11H11F3N4S |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (E)-[1-[3-(trifluoromethyl)phenyl]pyrazolidin-3-ylidene]thiourea |
| SMILES | NC(=S)/N=C1\CCN(c2cccc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C11H11F3N4S/c12-11(13,14)7-2-1-3-8(6-7)18-5-4-9(17-18)16-10(15)19/h1-3,6H,4-5H2,(H3,15,16,17,19) |
| InChIKey | WXZJIHGZKDORSN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|