C18H19F3N4O2 — CID 45382279
3-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione (PubChem CID 45382279) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 3-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 3-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 45382279 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]-1H-pyrimidine-2,4-dione |
| SMILES | C=CCn1c(=O)cc(N2CCN(c3cccc(C(F)(F)F)c3)CC2)[nH]c1=O |
| InChI | InChI=1S/C18H19F3N4O2/c1-2-6-25-16(26)12-15(22-17(25)27)24-9-7-23(8-10-24)14-5-3-4-13(11-14)18(19,20)21/h2-5,11-12H,1,6-10H2,(H,22,27) |
| InChIKey | OBDSPODXBUMISA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|