C24H29F3N4O2 — CID 45480138
3-cyclohexyl-1-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-dione (PubChem CID 45480138) has the molecular formula C24H29F3N4O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is 3-cyclohexyl-1-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-dione.
| Compound Name | 3-cyclohexyl-1-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 45480138 |
| Molecular Formula | C24H29F3N4O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 3-cyclohexyl-1-prop-2-enyl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-dione |
| SMILES | C=CCn1c(N2CCN(c3cccc(C(F)(F)F)c3)CC2)cc(=O)n(C2CCCCC2)c1=O |
| InChI | InChI=1S/C24H29F3N4O2/c1-2-11-30-21(17-22(32)31(23(30)33)19-8-4-3-5-9-19)29-14-12-28(13-15-29)20-10-6-7-18(16-20)24(25,26)27/h2,6-7,10,16-17,19H,1,3-5,8-9,11-15H2 |
| InChIKey | RAUHQSLNCVTOAE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|