C16H15N3 — CID 830683
1-phenyl-N-(2-phenyl-3,4-dihydropyrazol-5-yl)methanimine (PubChem CID 830683) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 1-phenyl-N-(2-phenyl-3,4-dihydropyrazol-5-yl)methanimine.
| Compound Name | 1-phenyl-N-(2-phenyl-3,4-dihydropyrazol-5-yl)methanimine |
|---|---|
| PubChem CID | 830683 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-phenyl-N-(2-phenyl-3,4-dihydropyrazol-5-yl)methanimine |
| SMILES | C(=N/C1=NN(c2ccccc2)CC1)\c1ccccc1 |
| InChI | InChI=1S/C16H15N3/c1-3-7-14(8-4-1)13-17-16-11-12-19(18-16)15-9-5-2-6-10-15/h1-10,13H,11-12H2/b17-13+ |
| InChIKey | UDYKAVIZNPTVDK-GHRIWEEISA-N |
| XLogP | 3.33 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|