C17H12Br2N4O2S — CID 2848711
2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol (PubChem CID 2848711) has the molecular formula C17H12Br2N4O2S and a molecular weight of 496.18 g/mol. Its IUPAC name is 2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol.
| Compound Name | 2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
|---|---|
| PubChem CID | 2848711 |
| Molecular Formula | C17H12Br2N4O2S |
| Molecular Weight | 496.18 g/mol |
| Exact Mass | 493.90 |
| IUPAC Name | 2,6-dibromo-4-(3-methylsulfanyl-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl)phenol |
| SMILES | CSc1nnc2c(n1)OC(c1cc(Br)c(O)c(Br)c1)Nc1ccccc1-2 |
| InChI | InChI=1S/C17H12Br2N4O2S/c1-26-17-21-16-13(22-23-17)9-4-2-3-5-12(9)20-15(25-16)8-6-10(18)14(24)11(19)7-8/h2-7,15,20,24H,1H3 |
| InChIKey | ULTNWGABTGMDHB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.18 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |