C23H16BrClN4O3S — CID 40736671
3-bromo-5-[(6S)-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,2-diol (PubChem CID 40736671) has the molecular formula C23H16BrClN4O3S and a molecular weight of 543.83 g/mol. Its IUPAC name is 3-bromo-5-[(6S)-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,2-diol.
| Compound Name | 3-bromo-5-[(6S)-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 40736671 |
| Molecular Formula | C23H16BrClN4O3S |
| Molecular Weight | 543.83 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | 3-bromo-5-[(6S)-3-[(2-chlorophenyl)methylsulfanyl]-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]benzene-1,2-diol |
| SMILES | Oc1cc([C@H]2Nc3ccccc3-c3nnc(SCc4ccccc4Cl)nc3O2)cc(Br)c1O |
| InChI | InChI=1S/C23H16BrClN4O3S/c24-15-9-13(10-18(30)20(15)31)21-26-17-8-4-2-6-14(17)19-22(32-21)27-23(29-28-19)33-11-12-5-1-3-7-16(12)25/h1-10,21,26,30-31H,11H2/t21-/m0/s1 |
| InChIKey | OCXCONSKFYBXBT-NRFANRHFSA-N |
| XLogP | 6.16 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.83 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|