C19H17N5OS2 — CID 28538471
7-methyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 28538471) has the molecular formula C19H17N5OS2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 7-methyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 7-methyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 28538471 |
| Molecular Formula | C19H17N5OS2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 7-methyl-N-[5-[(4-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1ccc(CSc2nnc(NC(=O)c3cn4ccc(C)cc4n3)s2)cc1 |
| InChI | InChI=1S/C19H17N5OS2/c1-12-3-5-14(6-4-12)11-26-19-23-22-18(27-19)21-17(25)15-10-24-8-7-13(2)9-16(24)20-15/h3-10H,11H2,1-2H3,(H,21,22,25) |
| InChIKey | CZXYGOFMYXSGOI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|