C23H31N3O5 — CID 2853851
3-[4-(morpholine-4-carbonyl)piperidin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione (PubChem CID 2853851) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-[4-(morpholine-4-carbonyl)piperidin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[4-(morpholine-4-carbonyl)piperidin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2853851 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 3-[4-(morpholine-4-carbonyl)piperidin-1-yl]-1-(4-propoxyphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCOc1ccc(N2C(=O)CC(N3CCC(C(=O)N4CCOCC4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H31N3O5/c1-2-13-31-19-5-3-18(4-6-19)26-21(27)16-20(23(26)29)24-9-7-17(8-10-24)22(28)25-11-14-30-15-12-25/h3-6,17,20H,2,7-16H2,1H3 |
| InChIKey | TUMHKKYOEKRNHW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|