C19H19FN2O3S2 — CID 28545025
4-fluoro-3-methyl-N-[4-(propan-2-ylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 28545025) has the molecular formula C19H19FN2O3S2 and a molecular weight of 406.50 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[4-(propan-2-ylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-3-methyl-N-[4-(propan-2-ylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 28545025 |
| Molecular Formula | C19H19FN2O3S2 |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 4-fluoro-3-methyl-N-[4-(propan-2-ylsulfamoyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(=O)(=O)NC(C)C)cc2)sc2cccc(F)c12 |
| InChI | InChI=1S/C19H19FN2O3S2/c1-11(2)22-27(24,25)14-9-7-13(8-10-14)21-19(23)18-12(3)17-15(20)5-4-6-16(17)26-18/h4-11,22H,1-3H3,(H,21,23) |
| InChIKey | UAIQUZKRTJNAON-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |