C8H7N3S — CID 28561
3-phenyl-1,2,4-thiadiazol-5-amine (PubChem CID 28561) has the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. Its IUPAC name is 3-phenyl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-phenyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 28561 |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 3-phenyl-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C8H7N3S/c9-8-10-7(11-12-8)6-4-2-1-3-5-6/h1-5H,(H2,9,10,11) |
| InChIKey | OYAHSBDYBOBAAQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |