C12H16N2O5 — CID 28561787
N-carbamoyl-2-[2-ethoxy-4-(hydroxymethyl)phenoxy]acetamide (PubChem CID 28561787) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-carbamoyl-2-[2-ethoxy-4-(hydroxymethyl)phenoxy]acetamide.
| Compound Name | N-carbamoyl-2-[2-ethoxy-4-(hydroxymethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 28561787 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-carbamoyl-2-[2-ethoxy-4-(hydroxymethyl)phenoxy]acetamide |
| SMILES | CCOc1cc(CO)ccc1OCC(=O)NC(N)=O |
| InChI | InChI=1S/C12H16N2O5/c1-2-18-10-5-8(6-15)3-4-9(10)19-7-11(16)14-12(13)17/h3-5,15H,2,6-7H2,1H3,(H3,13,14,16,17) |
| InChIKey | BWDUGYHRQHMWQJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |