C20H24N2O2 — CID 2856856
7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole (PubChem CID 2856856) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole.
| Compound Name | 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole |
|---|---|
| PubChem CID | 2856856 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole |
| SMILES | Cc1[nH]c2c(C34CC5CC(CC(C5)C3)C4)cc([N+](=O)[O-])cc2c1C |
| InChI | InChI=1S/C20H24N2O2/c1-11-12(2)21-19-17(11)6-16(22(23)24)7-18(19)20-8-13-3-14(9-20)5-15(4-13)10-20/h6-7,13-15,21H,3-5,8-10H2,1-2H3 |
| InChIKey | CLLLVULNOMQCRB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|