About 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole
7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole (PubChem CID 2856856) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole.
Molecular Properties
| Compound Name | 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole |
| PubChem CID | 2856856 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole |
| SMILES | Cc1[nH]c2c(C34CC5CC(CC(C5)C3)C4)cc([N+](=O)[O-])cc2c1C |
| InChI | InChI=1S/C20H24N2O2/c1-11-12(2)21-19-17(11)6-16(22(23)24)7-18(19)20-8-13-3-14(9-20)5-15(4-13)10-20/h6-7,13-15,21H,3-5,8-10H2,1-2H3 |
| InChIKey | CLLLVULNOMQCRB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole?
The IUPAC name of 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole (CID 2856856) is 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole.
What is the SMILES notation for 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole?
The canonical SMILES for 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole is Cc1[nH]c2c(C34CC5CC(CC(C5)C3)C4)cc([N+](=O)[O-])cc2c1C.
What is the InChIKey of 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole?
The InChIKey is CLLLVULNOMQCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2/c1-11-12(2)21-19-17(11)6-16(22(23)24)7-18(19)20-8-13-3-14(9-20)5-15(4-13)10-20/h6-7,13-15,21H,3-5,8-10H2,1-2H3.
What are the key properties of 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole?
7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole has a molecular weight of 324.42 g/mol, XLogP of 5.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-adamantyl)-2,3-dimethyl-5-nitro-1H-indole is sourced from PubChem (CID 2856856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).