C18H17N5O3 — CID 28579583
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl (E)-3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 28579583) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl (E)-3-(5-methylfuran-2-yl)prop-2-enoate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 28579583 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl (E)-3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCc2nc(N)nc(Nc3ccccc3)n2)o1 |
| InChI | InChI=1S/C18H17N5O3/c1-12-7-8-14(26-12)9-10-16(24)25-11-15-21-17(19)23-18(22-15)20-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H3,19,20,21,22,23)/b10-9+ |
| InChIKey | URYXXFFTHWNZCF-MDZDMXLPSA-N |
| XLogP | 2.86 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|